ethylenebis(oxyethylene) dinonanoate structure
|
Common Name | ethylenebis(oxyethylene) dinonanoate | ||
|---|---|---|---|---|
| CAS Number | 106-06-9 | Molecular Weight | 430.61800 | |
| Density | 0.965 g/mL at 25ºC(lit.) | Boiling Point | 210ºC(lit.) | |
| Molecular Formula | C24H46O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | tri(ethylene glycol) dinonanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 210ºC(lit.) |
| Molecular Formula | C24H46O6 |
| Molecular Weight | 430.61800 |
| Flash Point | >230 °F |
| Exact Mass | 430.32900 |
| PSA | 71.06000 |
| LogP | 5.60720 |
| Vapour Pressure | 5.37E-10mmHg at 25°C |
| Index of Refraction | n20/D 1.446(lit.) |
| InChIKey | UBQXQCCAPASFJR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)OCCOCCOCCOC(=O)CCCCCCCC |
| WGK Germany | 3 |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Nonanoic acid,1,2-ethanediylbis(oxy-2,1-ethanediyl) ester |
| MFCD00048956 |
| 1,2-bis-(2-nonanoyloxy-ethoxy)-ethane |
| TRIETHYLENE GLYCOL DIPELARGONATE |
| 2-(2-[2-(Nonanoyloxy)ethoxy]ethoxy)ethyl nonanoate |
| triethylene glycol dinonanoate |
| Dinonanoic acid ethylenebis(oxyethylene) ester |
| Triethyleneglycoldimethacrylatedinonanoate |
| 1,2-Bis-(2-nonanoyloxy-aethoxy)-aethan |
| ethylenebis(oxyethylene) dinonanoate |
| EINECS 203-357-2 |
| 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester |
| Nonanoic acid,diester with triethylene glycol |
| TEGdimethacrylatedinonanoate |