N,4-O,10-O,15-O-tetramethylryanodine structure
|
Common Name | N,4-O,10-O,15-O-tetramethylryanodine | ||
|---|---|---|---|---|
| CAS Number | 106821-53-8 | Molecular Weight | 549.65300 | |
| Density | 1.39g/cm3 | Boiling Point | 645ºC at 760mmHg | |
| Molecular Formula | C29H43NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.9ºC | |
| Name | N,4-O,10-O,15-O-tetramethylryanodine |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 645ºC at 760mmHg |
| Molecular Formula | C29H43NO9 |
| Molecular Weight | 549.65300 |
| Flash Point | 343.9ºC |
| Exact Mass | 549.29400 |
| PSA | 128.84000 |
| LogP | 1.78510 |
| Vapour Pressure | 1.62E-17mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | BXLDWDWPUYJUFH-UHFFFAOYSA-N |
| SMILES | COC1C(C)CCC2(O)C3(C)CC4(OC)OC12C1(O)C3(OC)C(OC(=O)c2cccn2C)C(O)(C(C)C)C41C |
|
~73%
N,4-O,10-O,15-O... CAS#:106821-53-8 |
| Literature: Waterhouse, Andrew L.; Pessah, Isaac N.; Francini, Alexander O.; Casida, John E. Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 710 - 716 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |