Octamethyltrisiloxane structure
|
Common Name | Octamethyltrisiloxane | ||
|---|---|---|---|---|
| CAS Number | 107-51-7 | Molecular Weight | 236.531 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 153.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H24O2Si3 | Melting Point | -82 °C | |
| MSDS | Chinese USA | Flash Point | 55.0±23.0 °C | |
| Symbol |
GHS02, GHS09 |
Signal Word | Warning | |
Use of Octamethyltrisiloxane |
| Name | Octamethyltrisiloxane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 153.0±0.0 °C at 760 mmHg |
| Melting Point | -82 °C |
| Molecular Formula | C8H24O2Si3 |
| Molecular Weight | 236.531 |
| Flash Point | 55.0±23.0 °C |
| Exact Mass | 236.108414 |
| PSA | 18.46000 |
| LogP | 4.74 |
| Vapour density | >1 (vs air) |
| Vapour Pressure | 4.4±0.2 mmHg at 25°C |
| Index of Refraction | 1.405 |
| InChIKey | CXQXSVUQTKDNFP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| Storage condition | Flammables area |
| Symbol |
GHS02, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H410 |
| Precautionary Statements | P273-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F+ |
| Risk Phrases | R10 |
| Safety Phrases | S23-S24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2934999090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
A novel pathway producing dimethylsulphide in bacteria is widespread in soil environments.
Nat. Commun. 6 , 6579, (2015) The volatile compound dimethylsulphide (DMS) is important in climate regulation, the sulphur cycle and signalling to higher organisms. Microbial catabolism of the marine osmolyte dimethylsulphonioprop... |
|
|
Microfluidics-based in situ padlock/rolling circle amplification system for counting single DNA molecules in a cell.
Anal. Sci. 30(12) , 1107-12, (2014) In situ padlock/rolling circle amplification (RCA) is a method used to amplify, visualize, and quantify target DNA molecules in cells. However, the multiple reaction steps involved make this technique... |
|
|
Combined effects of drying methods, extract concentration, and film thickness on efficacy of antimicrobial chitosan films.
J. Food Sci. 79(6) , E1150-8, (2014) An idea of using a suitable drying method to minimize the loss of added antimicrobial agent and, at the same time, to modify the structure, and hence the release characteristics of chitosan films was ... |
| Trisiloxane, 1,1,1,3,3,5,5,5-octamethyl- |
| Poly(Dimethylsiloxane) |
| Octamethyltrisiloxane |
| EINECS 203-497-4 |
| Dimethylbis(trimethylsilyloxy)silane |
| POLY(DIMETHYLSILOXANE),HYDROXY TERMINATED |
| POLY(DIMETHYLSILOXANE), HYDROXY TERMINATED |
| MFCD01325012 |