Boc-Tyr-OH structure
|
Common Name | Boc-Tyr-OH | ||
|---|---|---|---|---|
| CAS Number | 3978-80-1 | Molecular Weight | 281.304 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 484.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H19NO5 | Melting Point | 135-140ºC | |
| MSDS | Chinese USA | Flash Point | 247.1±27.3 °C | |
Use of Boc-Tyr-OH(S)-2-((tert-Butoxycarbonyl)amino)-3-(4-hydroxyphenyl)propanoic acid is a tyrosine derivative[1]. |
| Name | (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-2-((tert-Butoxycarbonyl)amino)-3-(4-hydroxyphenyl)propanoic acid is a tyrosine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 484.9±40.0 °C at 760 mmHg |
| Melting Point | 135-140ºC |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.304 |
| Flash Point | 247.1±27.3 °C |
| Exact Mass | 281.126312 |
| PSA | 95.86000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | CNBUSIJNWNXLQQ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Transport and signaling via the amino acid binding site of the yeast Gap1 amino acid transceptor.
Nat. Chem. Biol. 5 , 45-52, (2009) Transporter-related nutrient sensors, called transceptors, mediate nutrient activation of signaling pathways through the plasma membrane. The mechanism of action of transporting and nontransporting tr... |
|
|
Analyte separation by OMNiMIPs imprinted with multiple templates.
Biosens. Bioelectron. 25(3) , 604-8, (2009) Changes detected in the imprinting effect by OMNiMIPs imprinted with multiple templates appear to be a function of the maximum template loading. Below the maximum template loading, the polymers imprin... |
|
|
Tyrosine derivatization and preparative purification of the sialyl and asialy-N-linked oligosaccharides from porcine fibrinogen.
Arch. Biochem. Biophys. 312(1) , 151-7, (1994) The N-linked oligosaccharides from porcine fibrinogen were purified following their release from glycopeptides using N-glycosidase F. In separate experiments, both sialyl and asialyl oligosaccharides ... |
| N-tert-butoxycarbonyl-L-tyrosine |
| N-t-butoxycarbonyl-L-tyrosine |
| L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]- |
| Boc-L-tryptophan |
| Boc-L-Trp-OH |
| MFCD00037179 |
| Boc-Tyr-OH |
| Boc-Trp-OH |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-tyrosine |
| BOC-L-Tyrosine |
| N-((tert-Butoxy)carbonyl)-L-tyrosine |
| N-Boc-L-tyrosine |
| N-Boc-L-tryptophan |
| EINECS 223-613-7 |
| N-(tert-Butoxycarbonyl)-L-tyrosine |