GK187 structure
|
Common Name | GK187 | ||
|---|---|---|---|---|
| CAS Number | 1071001-50-7 | Molecular Weight | 310.260 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 330.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H15F5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5±22.8 °C | |
Use of GK187GK187 is a potent and selective Group VIA calcium-independent phospholipase A2 (GVIA iPLA2) inhibitor with an XI(50) value of 0.0001. GK187 can be used for researching various neurological disorders[1]. [The XI(50) is the mole fraction of the inhibitor in the total substrate interface required to inhibit the enzyme by 50%.] |
| Name | GK187 |
|---|---|
| Synonym | More Synonyms |
| Description | GK187 is a potent and selective Group VIA calcium-independent phospholipase A2 (GVIA iPLA2) inhibitor with an XI(50) value of 0.0001. GK187 can be used for researching various neurological disorders[1]. [The XI(50) is the mole fraction of the inhibitor in the total substrate interface required to inhibit the enzyme by 50%.] |
|---|---|
| Related Catalog | |
| Target |
XI(50): 0.0001 (GVIA iPLA2)[1] |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.3±42.0 °C at 760 mmHg |
| Molecular Formula | C14H15F5O2 |
| Molecular Weight | 310.260 |
| Flash Point | 148.5±22.8 °C |
| Exact Mass | 310.099213 |
| LogP | 5.32 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.438 |
| InChIKey | CICDFDPOGZQTQB-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCCCC(=O)C(F)(F)C(F)(F)F)cc1 |
| 3-Heptanone, 1,1,1,2,2-pentafluoro-7-(4-methoxyphenyl)- |
| 1,1,1,2,2-Pentafluoro-7-(4-methoxyphenyl)-3-heptanone |
| GK187 |