ethyl 1-((tert-butoxycarbonyl)amino)cyclopropanecarboxylate structure
|
Common Name | ethyl 1-((tert-butoxycarbonyl)amino)cyclopropanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 107259-05-2 | Molecular Weight | 229.273 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 307.0±21.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.5±22.1 °C | |
| Name | Ethyl 1-((tert-butoxycarbonyl)amino)cyclopropanecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.0±21.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.273 |
| Flash Point | 139.5±22.1 °C |
| Exact Mass | 229.131409 |
| PSA | 68.12000 |
| LogP | 1.59 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | VBXFYABGAOGXRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(NC(=O)OC(C)(C)C)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~57%
ethyl 1-((tert-... CAS#:107259-05-2 |
| Literature: Bridger, Gary; Skerlj, Renato; Kaller, Ai; Harwig, Curtis; Bogucki, David; Wilson, Trevor R.; Crawford, Jason; McEachern, Ernest J.; Atsma, Bem; Nan, Siqiao; Zhou, Yuanxi; Schols, Dominique; Smith, Christopher Dennis; Di Fluri, Maria Rosaria Patent: US2003/220341 A1, 2003 ; Location in patent: Page/Page column 49-50 ; US 20030220341 A1 |
|
~91%
ethyl 1-((tert-... CAS#:107259-05-2 |
| Literature: Wyeth Patent: US2008/45556 A1, 2008 ; Location in patent: Page/Page column 21 ; |
|
~%
ethyl 1-((tert-... CAS#:107259-05-2 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 20, # 7 p. 2151 - 2155 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| Ethyl 1-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)cyclopropanecarboxylate |
| Cyclopropanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, ethyl ester |
| Ethyl 1-[(tert-butoxycarbonyl)amino]cyclopropanecarboxylate |