1-(tert-Butoxycarbonylamino)cyclopropanecarboxaldehyde structure
|
Common Name | 1-(tert-Butoxycarbonylamino)cyclopropanecarboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 107259-06-3 | Molecular Weight | 185.220 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 280.7±19.0 °C at 760 mmHg | |
| Molecular Formula | C9H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.6±21.5 °C | |
| Name | tert-Butyl 1-formylcyclopropylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 280.7±19.0 °C at 760 mmHg |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.220 |
| Flash Point | 123.6±21.5 °C |
| Exact Mass | 185.105194 |
| PSA | 55.40000 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | ACMHCEYCNRURST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(C=O)CC1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
|
~96%
1-(tert-Butoxyc... CAS#:107259-06-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 25, # 6 p. 1769 - 1772 |
|
~%
1-(tert-Butoxyc... CAS#:107259-06-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 12 p. 2551 - 2568 |
|
~39%
1-(tert-Butoxyc... CAS#:107259-06-3 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 42, # 7 p. 1442 - 1454 |
|
~%
1-(tert-Butoxyc... CAS#:107259-06-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 12 p. 2551 - 2568 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-butyl N-(1-formylcyclopropyl)carbamate |
| Carbamic acid, N-(1-formylcyclopropyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate |