2-chloro-6-(chloromethyl)-13-phenyl-12H-benzo[d][1,3,7]benzotriazonine structure
|
Common Name | 2-chloro-6-(chloromethyl)-13-phenyl-12H-benzo[d][1,3,7]benzotriazonine | ||
|---|---|---|---|---|
| CAS Number | 107469-95-4 | Molecular Weight | 380.27000 | |
| Density | 1.325g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H15Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-6-(chloromethyl)-13-phenyl-12H-benzo[d][1,3,7]benzotriazonine |
|---|
| Density | 1.325g/cm3 |
|---|---|
| Molecular Formula | C21H15Cl2N3 |
| Molecular Weight | 380.27000 |
| Exact Mass | 379.06400 |
| PSA | 41.57000 |
| LogP | 6.29470 |
| Index of Refraction | 1.663 |
| InChIKey | QGECICVKOZNMLQ-UHFFFAOYSA-N |
| SMILES | ClCc1nc2ccccc2[nH]c(-c2ccccc2)c2cc(Cl)ccc2n1 |
|
~%
2-chloro-6-(chl... CAS#:107469-95-4
Detail
|
| Literature: Peet, Norton P.; Sunder, Shyam; Barbuch, Robert J.; Whalon, Michael R.; Huber, Edward W.; Huffman, John C. Journal of Heterocyclic Chemistry, 1989 , vol. 26, p. 1611 - 1618 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |