1-(2-hydroperoxypropan-2-yl)-4-phenylbenzene structure
|
Common Name | 1-(2-hydroperoxypropan-2-yl)-4-phenylbenzene | ||
|---|---|---|---|---|
| CAS Number | 107623-70-1 | Molecular Weight | 228.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroperoxypropan-2-yl)-4-phenylbenzene |
|---|
| Molecular Formula | C15H16O2 |
|---|---|
| Molecular Weight | 228.28600 |
| Exact Mass | 228.11500 |
| PSA | 29.46000 |
| LogP | 4.07830 |
| InChIKey | CVIWTMIBFCBFLR-UHFFFAOYSA-N |
| SMILES | CC(C)(OO)c1ccc(-c2ccccc2)cc1 |
|
~%
1-(2-hydroperox... CAS#:107623-70-1 |
| Literature: Melone, Lucio; Franchi, Paola; Lucarini, Marco; Punta, Carlo Advanced Synthesis and Catalysis, 2013 , vol. 355, # 16 p. 3210 - 3220 |
|
~%
1-(2-hydroperox... CAS#:107623-70-1 |
| Literature: Stec, Zbigniew; Orlinska, Beata; Jakubowski, BartLomiej; Zawadiak, Jan International Journal of Chemical Kinetics, 2008 , vol. 40, # 9 p. 527 - 532 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |