1h,1h,2h,3h,3h-perfluorononane-1,2-diol structure
|
Common Name | 1h,1h,2h,3h,3h-perfluorononane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 107650-06-6 | Molecular Weight | 394.13000 | |
| Density | 1.617g/cm3 | Boiling Point | 120-130°C | |
| Molecular Formula | C9H7F13O2 | Melting Point | 63-64°C | |
| MSDS | N/A | Flash Point | >150°C | |
| Name | 1h,1h,2h,3h,3h-perfluorononane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.617g/cm3 |
|---|---|
| Boiling Point | 120-130°C |
| Melting Point | 63-64°C |
| Molecular Formula | C9H7F13O2 |
| Molecular Weight | 394.13000 |
| Flash Point | >150°C |
| Exact Mass | 394.02400 |
| PSA | 40.46000 |
| LogP | 3.46850 |
| Vapour Pressure | 0.0432mmHg at 25°C |
| Index of Refraction | 1.322 |
| InChIKey | DAHZCNRVTNHGGR-UHFFFAOYSA-N |
| SMILES | OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2905590090 |
|
~88%
1h,1h,2h,3h,3h-... CAS#:107650-06-6 |
| Literature: Zuo, Liangbin; Qing, Feng-Ling; Meng, Wei-Dong; Huang, Xiaoyu; Zhang, Sen; Wu, Qiang Journal of Fluorine Chemistry, 2004 , vol. 125, # 10 p. 1441 - 1446 |
|
~96%
1h,1h,2h,3h,3h-... CAS#:107650-06-6 |
| Literature: Cirkva, Vladimir; Ameduri, Bruno; Boutevin, Bernard; Paleta, Oldrich Journal of Fluorine Chemistry, 1997 , vol. 84, # 1 p. 53 - 61 |
|
~%
1h,1h,2h,3h,3h-... CAS#:107650-06-6 |
| Literature: Journal of Fluorine Chemistry, , vol. 84, # 1 p. 53 - 61 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononane-1,2-diol |
| MFCD00042262 |