3-perfluorooctyl-2-iodopropanol structure
|
Common Name | 3-perfluorooctyl-2-iodopropanol | ||
|---|---|---|---|---|
| CAS Number | 38550-45-7 | Molecular Weight | 604.04200 | |
| Density | 1.888 g/cm3 | Boiling Point | 248.1ºC at 760 mmHg | |
| Molecular Formula | C11H6F17IO | Melting Point | 54ºC | |
| MSDS | N/A | Flash Point | 103.8ºC | |
| Name | 1H,1H,2H,3H,3H-2-Iodoperfluoroundecan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.888 g/cm3 |
|---|---|
| Boiling Point | 248.1ºC at 760 mmHg |
| Melting Point | 54ºC |
| Molecular Formula | C11H6F17IO |
| Molecular Weight | 604.04200 |
| Flash Point | 103.8ºC |
| Exact Mass | 603.91900 |
| PSA | 20.23000 |
| LogP | 6.18180 |
| Index of Refraction | 1.356 |
| InChIKey | WNOHMWCTVWXSJC-UHFFFAOYSA-N |
| SMILES | OCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundecan-1-ol |
| MFCD00236072 |