4-[(4,6-Dimethylpyrimidin-2-yl)thio]phenol structure
|
Common Name | 4-[(4,6-Dimethylpyrimidin-2-yl)thio]phenol | ||
|---|---|---|---|---|
| CAS Number | 107718-34-3 | Molecular Weight | 232.30100 | |
| Density | 1.29g/cm3 | Boiling Point | 458ºC at 760mmHg | |
| Molecular Formula | C12H12N2OS | Melting Point | 192-193ºC | |
| MSDS | USA | Flash Point | 230.8ºC | |
| Name | 4-[(4,6-Dimethylpyrimidin-2-yl)thio]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 458ºC at 760mmHg |
| Melting Point | 192-193ºC |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.30100 |
| Flash Point | 230.8ºC |
| Exact Mass | 232.06700 |
| PSA | 71.31000 |
| LogP | 2.95020 |
| Vapour Pressure | 5.21E-09mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | FBCAKJCKGFHPEQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(Sc2ccc(O)cc2)n1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 22-36 |
| Safety Phrases | 26 |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00203057 |
| 4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenol |