4,5-DIFLUORO-2-METHYLBROMOBENZENE structure
|
Common Name | 4,5-DIFLUORO-2-METHYLBROMOBENZENE | ||
|---|---|---|---|---|
| CAS Number | 107869-45-4 | Molecular Weight | 213.297 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 337.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H15NO2S | Melting Point | 229-230ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 157.8±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (+)-10-camphorsulfonimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.2±25.0 °C at 760 mmHg |
| Melting Point | 229-230ºC(lit.) |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.297 |
| Flash Point | 157.8±23.2 °C |
| Exact Mass | 213.082352 |
| PSA | 54.88000 |
| LogP | 0.02 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | ZAHOEBNYVSWBBW-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CCC13CS(=O)(=O)N=C3C2 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
~99%
4,5-DIFLUORO-2-... CAS#:107869-45-4 |
| Literature: Vandewalle, M.; Van der Eycken, J.; Oppolzer, W.; Vullioud, C. Tetrahedron, 1986 , vol. 42, # 14 p. 4035 - 4044 |
|
~%
4,5-DIFLUORO-2-... CAS#:107869-45-4 |
| Literature: Organic Letters, , vol. 2, # 26 p. 4157 - 4160 |
|
~%
4,5-DIFLUORO-2-... CAS#:107869-45-4 |
| Literature: Organic Letters, , vol. 2, # 26 p. 4157 - 4160 |
|
J. Org. Chem. 51 , 2402, (1986)
|
| (3Ar)-(+)-8,8-dimethyl-4,5,6,7-tetrahydro-3H-3a,6-methano-2,1-benzisothiazole 2,2-dioxide |
| (7R)-(+)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.01,5]dec-4-ene 3,3-Dioxide |
| 3H-3a,6-Methano-2,1-benzisothiazole, 4,5,6,7-tetrahydro-8,8-dimethyl-, 2,2-dioxide, (3aR)- |
| (+)-10-Camphorsulfonimine |
| (+)-(camphorsulfonyl)imine |
| MFCD00013315 |
| (1R)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.0]dec-4-ene 3,3-dioxide |
| (3aR)-(+)-4,5,6,7-Tetrahydro-8,8-dimethyl-3H-3a,6-methano-2,1-benzisothiazole 2,2-Dioxide |