(2S)-Bornane-10,2-sultam structure
|
Common Name | (2S)-Bornane-10,2-sultam | ||
|---|---|---|---|---|
| CAS Number | 108448-77-7 | Molecular Weight | 215.313 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 324.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO2S | Melting Point | 181-185ºC | |
| MSDS | N/A | Flash Point | 150.3±23.2 °C | |
| Name | (+)-10,2-Camphorsultam |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 324.8±25.0 °C at 760 mmHg |
| Melting Point | 181-185ºC |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.313 |
| Flash Point | 150.3±23.2 °C |
| Exact Mass | 215.097992 |
| PSA | 54.55000 |
| LogP | 1.04 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | DPJYJNYYDJOJNO-KTOWXAHTSA-N |
| SMILES | CC1(C)C2CCC13CS(=O)(=O)NC3C2 |
| Storage condition | 2~8°C |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2934991000 |
| Precursor 5 | |
|---|---|
| DownStream 3 | |
| HS Code | 2934991000 |
|---|---|
| Summary | 2934991000. sultones and sultams. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-2,10-Camphorsultam |
| MFCD00151762 |
| (1R,5S)-10,10-Dimethyl-3-Thia-4-Azatricyclo[5.2.1.0(1,5)]Decane 3,3-Dioxide |
| (-)-10,2-Camphorsultam |
| (1S,5R,7R)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.0]decane 3,3-dioxide |
| (2S)-Bornane-10,2-sultam |
| Oppolzer's sultam |
| (3aS,6R,7aR)-8,8-Dimethylhexahydro-3a,6-methano-2,1-benzisothiazole 2,2-dioxide |
| (1R,5S)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.0]decane 3,3-dioxide |
| (1R)-(+)-2,10-Camphorsultam |
| (1S)-(-)-2,10-Camphorsultam |
| (1R)-(+)-2,10,Camphorsultam |
| (+)-exo-10,2-Bornanesultam |
| (1R,5S)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |