N-p-Tosylglycine structure
|
Common Name | N-p-Tosylglycine | ||
|---|---|---|---|---|
| CAS Number | 1080-44-0 | Molecular Weight | 229.253 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 430.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C9H11NO4S | Melting Point | 147-149 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 213.9±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-p-TosylglycineN-p-Tosylglycine is a Glycine (HY-Y0966) derivative[1]. |
| Name | N-p-Tosylglycine |
|---|---|
| Synonym | More Synonyms |
| Description | N-p-Tosylglycine is a Glycine (HY-Y0966) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 430.0±55.0 °C at 760 mmHg |
| Melting Point | 147-149 °C(lit.) |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.253 |
| Flash Point | 213.9±31.5 °C |
| Exact Mass | 229.040878 |
| PSA | 91.85000 |
| LogP | 1.07 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | VDKFCCZUCXYILI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)O)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Facilitation of insulin release by N-p-tosylglycine.
Biochem. Pharmacol. 34(14) , 2495-9, (1985) N-p-tosylglycine, which inhibits transglutaminase activity in islet homogenates, was found to cause a rapid and sustained facilitation of insulin release evoked by D-glucose, L-leucine or the associat... |
| Glycine, N-[(4-methylphenyl)sulfonyl]- |
| N-[(4-Methylphenyl)sulfonyl]glycine |
| 2-(4-Methylphenylsulfonamido)acetic acid |
| N-P-TOSYLGLYCINE |
| 2-[(4-methylphenyl)sulfonylamino]acetic acid |
| N-(p-Toluenesulfonyl)glycine |
| N-Tosylglycine |
| MFCD00045898 |
| tos-gly-oh |