Benzenebutanoic acid,2,5-dimethoxy-g-oxo- structure
|
Common Name | Benzenebutanoic acid,2,5-dimethoxy-g-oxo- | ||
|---|---|---|---|---|
| CAS Number | 1084-74-8 | Molecular Weight | 238.23700 | |
| Density | 1.211g/cm3 | Boiling Point | 429.1ºC at 760mmHg | |
| Molecular Formula | C12H14O5 | Melting Point | 102-106ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 166ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(2,5-dimethoxyphenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 429.1ºC at 760mmHg |
| Melting Point | 102-106ºC(lit.) |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.23700 |
| Flash Point | 166ºC |
| Exact Mass | 238.08400 |
| PSA | 72.83000 |
| LogP | 1.75130 |
| Vapour Pressure | 3.98E-08mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | HSFBDVDTGCGJBZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)CCC(=O)O)c1 |
|
~93%
Benzenebutanoic... CAS#:1084-74-8 |
| Literature: Sartori, Giovanni; Bigi, Franca; Goffredi, Gino; Maggi, Raimondo; Portioli, Roberto; Casnati, Giuseppe Journal of Chemical Research, Miniprint, 1993 , # 8 p. 2061 - 2079 |
|
~%
Benzenebutanoic... CAS#:1084-74-8 |
| Literature: Journal of Organic Chemistry, , vol. 65, # 20 p. 6319 - 6337 |
|
~58%
Benzenebutanoic... CAS#:1084-74-8 |
| Literature: Perry, Gregory J.; Sutherland, Maurice D. Tetrahedron, 1982 , vol. 38, # 10 p. 1471 - 1476 |
|
~%
Benzenebutanoic... CAS#:1084-74-8 |
| Literature: Journal of the Chemical Society, , p. 1985,1988 |
|
~%
Benzenebutanoic... CAS#:1084-74-8 |
| Literature: Gazzetta Chimica Italiana, , vol. 42 I, p. 205 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-dimethoxybenzoyl propionic acid |
| 4-(2',5'-dimethoxyphenyl)-4-oxobutyric acid |
| 3-(2,5-dimethoxybenzoyl)propionic acid |
| MFCD00089268 |
| benzenebutanoic acid,2,5-dimethoxy-|A-oxo |