(D-Arg0,Hyp3,D-Phe7)-Bradykinin trifluoroacetate salt structure
|
Common Name | (D-Arg0,Hyp3,D-Phe7)-Bradykinin trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 109333-26-8 | Molecular Weight | 1282.45 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C60H87N19O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (D-Arg0,Hyp3,D-Phe7)-Bradykinin trifluoroacetate saltNPC-567 is a bradykinin B2 receptor antagonist. NPC-567 is effective in inhibiting the acute response to allergen in the airways[1][2]. |
| Name | [D-Arg0,Hyp3,D-Phe7]-Bradykinin |
|---|---|
| Synonym | More Synonyms |
| Description | NPC-567 is a bradykinin B2 receptor antagonist. NPC-567 is effective in inhibiting the acute response to allergen in the airways[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C60H87N19O13 |
| Molecular Weight | 1282.45 |
| Exact Mass | 1281.673096 |
| PSA | 533.80000 |
| LogP | -2.56 |
| Index of Refraction | 1.691 |
| InChIKey | RBIXVHPHNGXTCI-QJTYZATASA-N |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)N1CC(O)CC1C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC(CO)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| WGK Germany | 3 |
|---|
| (D-ARG0,HYP3,D-PHE7)-BRADYKININ |
| D-Arg-L-Pro-L-t4Hyp-Gly-L-Phe-L-Ser-D-Phe-L-Phe-D-Arg-OH |
| D-ARG-ARG-PRO-HYDROXY-PRO-GLY-PHE-SER-D-PHE-PHE-ARG |
| D-ARG-ARG-PRO-HYP-GLY-PHE-SER-D-PHE-PHE-ARG |
| D-Phe7]-bradykinin |
| D-Arg-Arg-Pro-Hyp-Gly-Phe-Phe-Arg |
| (D-Arg0,Hyp3,D-Phe7)bradikinin |
| D-Arg[Hyp3,D-Phe7]-bradykinin |
| D-Arg-Arg-Pro-t4Hyp-Gly-Phe-Ser-D-Phe-Phe-Arg-OH |
| L-Arginine, D-arginyl-L-arginyl-L-prolyl-(4R)-4-hydroxy-L-prolylglycyl-L-phenylalanyl-L-seryl-D-phenylalanyl-L-phenylalanyl- |
| npc567 |
| D-Arg-L-Arg-L-Pro-L-t4Hyp-Gly-L-Phe-L-Ser-D-Phe-L-Phe-L-Arg-OH |
| D-Arginyl-L-arginyl-L-prolyl-(4R)-4-hydroxy-L-prolylglycyl-L-phenylalanyl-L-seryl-D-phenylalanyl-L-phenylalanyl-L-arginine |
| H-D-ARG-ARG-PRO-HYP-GLY-PHE-SER-D-PHE-PHE-ARG-OH |