Roflupram structure
|
Common Name | Roflupram | ||
|---|---|---|---|---|
| CAS Number | 1093412-18-0 | Molecular Weight | 314.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20F2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RoflupramRoflupram is a selective, orally active and brain-penetrant PDE4 inhibitor, with an IC50 of 26.2 nM for core catalytic domains of human PDE4. Roflupram can reverse cognitive deficits and reduce the production of pro-inflammatory factors[1][2]. |
| Name | Roflupram |
|---|
| Description | Roflupram is a selective, orally active and brain-penetrant PDE4 inhibitor, with an IC50 of 26.2 nM for core catalytic domains of human PDE4. Roflupram can reverse cognitive deficits and reduce the production of pro-inflammatory factors[1][2]. |
|---|---|
| Related Catalog | |
| Target |
PDE4:26.2 nM (IC50) |
| References |
| Molecular Formula | C16H20F2O4 |
|---|---|
| Molecular Weight | 314.32 |
| InChIKey | IXURVUHDDXFYDR-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)c1ccc(OC(F)F)c(OC2CCOC2)c1 |