tert-butyl 4-azidopiperidine-1-carboxylate(SALTDATA: FREE) structure
|
Common Name | tert-butyl 4-azidopiperidine-1-carboxylate(SALTDATA: FREE) | ||
|---|---|---|---|---|
| CAS Number | 180695-80-1 | Molecular Weight | 226.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N4O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | diazonio-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azanide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H18N4O2 |
|---|---|
| Molecular Weight | 226.27600 |
| Exact Mass | 226.14300 |
| PSA | 79.29000 |
| LogP | 2.08686 |
| InChIKey | NKZZRYWSQYJWJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N=[N+]=[N-])CC1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-azidopiperidine-1-carboxylate |
| 4-azido-1-t-butoxycarbonylpiperidine |
| 4-azido-N-tert-butoxycarbonylpiperidine |
| 4-azido-1-(tert-butoxycarbonyl)piperidine |
| 4-azido-piperidine-1-carboxylic acid tert-butyl ester |