2-Nitro-4-(trifluoromethyl)benzaldehyde structure
|
Common Name | 2-Nitro-4-(trifluoromethyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 109466-87-7 | Molecular Weight | 219.117 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 273.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F3NO3 | Melting Point | 41-45 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 119.4±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Nitro-4-(trifluoromethyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 273.8±40.0 °C at 760 mmHg |
| Melting Point | 41-45 °C(lit.) |
| Molecular Formula | C8H4F3NO3 |
| Molecular Weight | 219.117 |
| Flash Point | 119.4±27.3 °C |
| Exact Mass | 219.014328 |
| PSA | 62.89000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | CTSYMGKKRHIYIH-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36-43 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2913000090 |
|
~56%
2-Nitro-4-(trif... CAS#:109466-87-7 |
| Literature: Lewandowska, Elzbieta; Kinastowski, Stefan; Wnuk, Stanislaw F. Canadian Journal of Chemistry, 2002 , vol. 80, # 2 p. 192 - 199 |
|
~%
2-Nitro-4-(trif... CAS#:109466-87-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 10 p. 1774 - 1779 |
|
~%
2-Nitro-4-(trif... CAS#:109466-87-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 10 p. 1774 - 1779 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2-Nitro-4-(trifluoromethyl)benzaldehyde |
| Benzaldehyde, 2-nitro-4-(trifluoromethyl)- |
| 2-nitro-4-trifluoromethylbenzaldehyde |