2-NITRO-4-(TRIFLUOROMETHYL)BENZONITRILE structure
|
Common Name | 2-NITRO-4-(TRIFLUOROMETHYL)BENZONITRILE | ||
|---|---|---|---|---|
| CAS Number | 778-94-9 | Molecular Weight | 216.11700 | |
| Density | 1.49 g/cm3 | Boiling Point | 156-158 °C18 mm Hg(lit.) | |
| Molecular Formula | C8H3F3N2O2 | Melting Point | 44-47 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-nitro-4-(trifluoromethyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49 g/cm3 |
|---|---|
| Boiling Point | 156-158 °C18 mm Hg(lit.) |
| Melting Point | 44-47 °C(lit.) |
| Molecular Formula | C8H3F3N2O2 |
| Molecular Weight | 216.11700 |
| Flash Point | >230 °F |
| Exact Mass | 216.01500 |
| PSA | 69.61000 |
| LogP | 3.00848 |
| InChIKey | BQCWLXXZTCLGSZ-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Studies on the rearrangement of ortho-nitrobenzylidenemalonates and their Analogues to 2-aminobenzoate derivatives. Lewandowska E, et al.
Can. J. Chem. 80(2) , 192-99, (2002)
|
| 2-Nitro-4-trifluoromethylbenzotrile |
| 4-Cyano-3-nitrobenzotrifluoride |
| 2-Nitro-4-trifluormethyl-benzonitril |
| EINECS 212-298-1 |
| MFCD00014684 |
| 4-cyano-3-nitro-1-trifluoromethylbenzene |