1,3-Benzenedicarboxylic acid, 5-(hydroxyMethyl)-, 1,3-dimethyl ester structure
|
Common Name | 1,3-Benzenedicarboxylic acid, 5-(hydroxyMethyl)-, 1,3-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 109862-53-5 | Molecular Weight | 224.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 5-(hydroxymethyl)benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12O5 |
|---|---|
| Molecular Weight | 224.21000 |
| Exact Mass | 224.06800 |
| PSA | 72.83000 |
| LogP | 0.75210 |
| InChIKey | JMGDEIHUEMPLRO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(CO)cc(C(=O)OC)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| dimethyl 5-hydroxymethylbenzene-1,3-dicarboxylate |
| 5-Hydroxymethyl-isophthalsaeure-dimethylester |
| dimethyl-(5-hydroxymethyl)isophthalate |
| 5-hydroxymethylisophthalic acid dimethyl ester |