Trimesic acid structure
|
Common Name | Trimesic acid | ||
|---|---|---|---|---|
| CAS Number | 554-95-0 | Molecular Weight | 210.14 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 561.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H6O6 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 307.4±25.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Trimesic acidBenzene-1,3,5-tricarboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | benzene-1,3,5-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Benzene-1,3,5-tricarboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.4±45.0 °C at 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C9H6O6 |
| Molecular Weight | 210.14 |
| Flash Point | 307.4±25.2 °C |
| Exact Mass | 210.016434 |
| PSA | 111.90000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | QMKYBPDZANOJGF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| Stability | Stable, but may be light sensitive. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
TGF-beta receptor type-2 expression in cancer-associated fibroblasts regulates breast cancer cell growth and survival and is a prognostic marker in pre-menopausal breast cancer.
Oncogene 34(1) , 27-38, (2015) Transforming growth factor-beta (TGF-β) is a pleiotropic cytokine with the capability to act as tumour suppressor or tumour promoter depending on the cellular context. TGF-beta receptor type-2 (TGFBR2... |
|
|
Loss of TGFβ Receptor Type 2 Expression Impairs Estrogen Response and Confers Tamoxifen Resistance.
Cancer Res. 75(7) , 1457-69, (2015) One third of the patients with estrogen receptor α (ERα)-positive breast cancer who are treated with the antiestrogen tamoxifen will either not respond to initial therapy or will develop drug resistan... |
|
|
Hygroscopic and phase transition properties of alkyl aminium sulfates at low relative humidities.
Phys. Chem. Chem. Phys. 17 , 19789-96, (2015) Alkyl aminium sulfates (AASs) can affect the physicochemical properties of atmospheric aerosols such as hygroscopicity. Previous laboratory experiments have shown that the water content in AAS bulk so... |
| Trimesitinic acid |
| Trimesic acid |
| Trimesinic acid |
| benzene-1,3,5-tricarboxylic acid |
| 1,3,5-Tricarboxybenzene |
| 1,3,5 benzene tricarboxylic acid |
| MFCD00002517 |
| 1,3,5-Benzene tricarboxylic acid |
| EINECS 209-077-7 |
| 1,3,5-Benzenetricarboxylic acid |
| 5-Carboxyisophthalic acid |