2,3,7,8-Tetramethoxydibenzofuran structure
|
Common Name | 2,3,7,8-Tetramethoxydibenzofuran | ||
|---|---|---|---|---|
| CAS Number | 109881-52-9 | Molecular Weight | 288.29500 | |
| Density | 1.219 g/cm3 | Boiling Point | 411.9ºC at 760 mmHg | |
| Molecular Formula | C16H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.2ºC | |
| Name | 2,3,7,8-Tetramethoxydibenzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219 g/cm3 |
|---|---|
| Boiling Point | 411.9ºC at 760 mmHg |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29500 |
| Flash Point | 218.2ºC |
| Exact Mass | 288.10000 |
| PSA | 50.06000 |
| LogP | 3.62040 |
| Vapour Pressure | 1.29E-06mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | IGGYWIWIIDEXTQ-UHFFFAOYSA-N |
| SMILES | COc1cc2oc3cc(OC)c(OC)cc3c2cc1OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,7,8-tetramethoxydibenzofuran |