Digitonin structure
|
Common Name | Digitonin | ||
|---|---|---|---|---|
| CAS Number | 11024-24-1 | Molecular Weight | 1229.312 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C56H92O29 | Melting Point | 230-240ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of DigitoninDigitonin, a glycoside obtained from Digitalis purpurea, could increase cell permeability by binding to cholesterol molecules and reduce tumor growth. |
| Name | digitonin |
|---|---|
| Synonym | More Synonyms |
| Description | Digitonin, a glycoside obtained from Digitalis purpurea, could increase cell permeability by binding to cholesterol molecules and reduce tumor growth. |
|---|---|
| Related Catalog | |
| In Vitro | Digitonin, a detergent that increases cell permeability by binding to cholesterol molecules in the cell membrane, can increase cisplatin accumulation and reduce tumour growth in vitro[1]. |
| In Vivo | In the liver parenchyma the concentrations are of the same magnitude. Measured with the 133Xe-clearance technique, Digitonin does not alter the tumor blood flow. Digitonin enhances the tumor-growth retarding effect of CBDCA given intra-aterially at 5 mg/kg but not at 25 mg/kg[1]. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | 230-240ºC |
| Molecular Formula | C56H92O29 |
| Molecular Weight | 1229.312 |
| Exact Mass | 1228.572388 |
| PSA | 454.67000 |
| LogP | -0.62 |
| Index of Refraction | 1.660 |
| InChIKey | UVYVLBIGDKGWPX-YCCXZQINSA-N |
| SMILES | CC1CCC2(OC1)OC1C(O)C3C4CCC5CC(OC6OC(CO)C(OC7OC(CO)C(O)C(OC8OCC(O)C(O)C8O)C7OC7OC(CO)C(O)C(OC8OC(CO)C(O)C(O)C8O)C7O)C(O)C6O)C(O)CC5(C)C4CCC3(C)C1C2C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H330 |
| Precautionary Statements | P260-P280-P284-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | R23/24/25 |
| Safety Phrases | S22-S28-S36/37-S45 |
| RIDADR | UN 3462 |
| WGK Germany | 3 |
| RTECS | IH2050050 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 29389090 |
|
Daclatasvir inhibits hepatitis C virus NS5A motility and hyper-accumulation of phosphoinositides.
Virology 476 , 168-79, (2015) Combinations of direct-acting antivirals (DAAs) against the hepatitis C virus (HCV) have the potential to revolutionize the HCV therapeutic regime. An integral component of DAA combination therapies i... |
|
|
Mitochondrial targeting of bilirubin regulatory enzymes: An adaptive response to oxidative stress.
Toxicol. Appl. Pharmacol. 282(1) , 77-89, (2015) The intracellular level of bilirubin (BR), an endogenous antioxidant that is cytotoxic at high concentrations, is tightly controlled within the optimal therapeutic range. We have recently described a ... |
|
|
Targeting cell surface TLR7 for therapeutic intervention in autoimmune diseases.
Nat. Commun. 6 , 6119, (2015) Toll-like receptor 7 (TLR7) senses microbial-derived RNA but can also potentially respond to self-derived RNA. To prevent autoimmune responses, TLR7 is thought to localize in endolysosomes. Contrary t... |
| MFCD00077729 |
| DigitoninGr |
| (2α,3β,5α,15β,25R)-2,15-Dihydroxyspirostan-3-yl β-D-glucopyranosyl-(1->3)-β-D-galactopyranosyl-(1->2)-[β-D-xylopyranosyl-(1->;3)]-β-D-glucopyranosyl-(1->4)-β-D-galactopyranoside |
| β-D-Galactopyranoside, (2α,3β,5α,15β,25R)-2,15-dihydroxyspirostan-3-yl O-β-D-glucopyranosyl-(1->3)-O-β-D-galactopyranosyl-(1->2)-O-[β-D-xylopyranosyl-(1->3)]-O-β-D-glucopy ranosyl-(1->4)- |
| galactopyranoside] |
| yl-(1.fwdarw.4) |
| β-D-galactopyranoside, (2α,3β,5α,15β,25R)-2,15-dihydroxyspirostan-3-yl O-β-D-glucopyranosyl-(1->3)-O-β-D-galactopyranosyl-(1->2)-O-[β-D-xylopyranosyl-(1->3)]-O-β-D-glucopyranosyl-(1->4)- |
| (2a,3b,5a,15b,25R)-2,15-Dihydroxyspirostan-3-yl O-b-D-glucopyranosyl-(1®3)-O-b-D-galactopyranosyl-(1®2)-O-(b-D-xylopyranosyl-(1®3))-O-b-D-glucopyranosyl-(1®4)-b-D-galactopyranoside |
| EINECS 234-255-6 |
| DIGITIN |
| (2α,3β,5α,15β,25R)-2,15-Dihydroxyspirostan-3-yl β-D-glucopyranosyl-(1->3)-β-D-galactopyranosyl-(1->2)-[β-D-xylopyranosyl-(1->;3)]-β-D-glucopyranosyl-(1->4)-β-D-galactopyran 
oside |
| Digitonin,Digitin |
| Digitonin |