2-Isopropenyl-7H-furo[3,2-g][1]benzopyran-7-one structure
|
Common Name | 2-Isopropenyl-7H-furo[3,2-g][1]benzopyran-7-one | ||
|---|---|---|---|---|
| CAS Number | 11037-15-3 | Molecular Weight | 226.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-Isopropenyl-7H-furo[3,2-g][1]benzopyran-7-oneArnocoumarin is a naural compound that can be isolated from X. arnottianum MAXIM[1]. |
| Name | 2-prop-1-en-2-ylfuro[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | Arnocoumarin is a naural compound that can be isolated from X. arnottianum MAXIM[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H10O3 |
|---|---|
| Molecular Weight | 226.23 |
| Exact Mass | 226.06300 |
| PSA | 43.35000 |
| LogP | 3.57230 |
| InChIKey | ILVSRSSJBQSUJM-UHFFFAOYSA-N |
| SMILES | C=C(C)c1cc2cc3ccc(=O)oc3cc2o1 |
| Arnocoumarin |
| 2-(1-Methylethenyl)-7H-furo(3,2-g)(1)benzopyran-7-one |
| hemiprangosine |
| 7H-Furo(3,2-g)(1)benzopyran-7-one,2-(1-methylethenyl) |