hmt structure
|
Common Name | hmt | ||
|---|---|---|---|---|
| CAS Number | 62442-59-5 | Molecular Weight | 258.26900 | |
| Density | 1.302 g/cm3 | Boiling Point | 388.2ºC at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.6ºC | |
| Name | 3-(hydroxymethyl)-2,5,9-trimethyl-7h-furo[3,2-g][1]benzopyran-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302 g/cm3 |
|---|---|
| Boiling Point | 388.2ºC at 760 mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.26900 |
| Flash Point | 188.6ºC |
| Exact Mass | 258.08900 |
| PSA | 63.58000 |
| LogP | 2.95670 |
| Index of Refraction | 1.631 |
| InChIKey | RGJSDHXSAKMPNM-UHFFFAOYSA-N |
| SMILES | Cc1oc2c(C)c3oc(=O)cc(C)c3cc2c1CO |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 22-26-27-36/37/39-45 |
| RIDADR | UN 1759 8 |
| HS Code | 2932999099 |
|
~75%
hmt CAS#:62442-59-5 |
| Literature: Marker Gene Technologies, Inc. Patent: US6656917 B1, 2003 ; Location in patent: Page column 15 ; |
|
~48%
hmt CAS#:62442-59-5 |
| Literature: Militsopoulou, Maria; Bariamis, Stavros E.; Athanassopoulos, Constantinos M.; Papaioannou, Dionissios Synthesis, 2008 , # 21 art. no. T08808SS, p. 3433 - 3442 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMT |
| hydroxymethyltrioxsalen |
| 4'-HYDROXYMETHYLTRIOXSALEN |
| 4'-hydroxymethyl-4-5'-8 trimethylpsoralen |
| 4'-Hydroxymethyl-trimethylpsoralen |