EM574 structure
|
Common Name | EM574 | ||
|---|---|---|---|---|
| CAS Number | 110480-13-2 | Molecular Weight | 743.96 | |
| Density | 1.18g/cm3 | Boiling Point | 804ºC at 760mmHg | |
| Molecular Formula | C39H69NO12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 440.1ºC | |
Use of EM574EM574 is a potent motilin receptor agonist in the human gastric antrum and rabbit gastrointestinal tract in vitro. EM574 is an erythromycin derivative[1]. |
| Name | Ddz-L-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Description | EM574 is a potent motilin receptor agonist in the human gastric antrum and rabbit gastrointestinal tract in vitro. EM574 is an erythromycin derivative[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 804ºC at 760mmHg |
| Molecular Formula | C39H69NO12 |
| Molecular Weight | 743.96 |
| Flash Point | 440.1ºC |
| Exact Mass | 743.48200 |
| PSA | 165.84000 |
| LogP | 3.67090 |
| Vapour Pressure | 6.53E-30mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | FPBKIOZMKHHNLL-CBUZSSJJSA-N |
| SMILES | CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(OC2OC(C)CC(N(C)C(C)C)C2O)C2(C)CC(C)=C(O2)C(C)C(O)C1(C)O |
| Ddz-Phe-OH |
| (2S)-2-[({[2-(3,5-dimethoxyphenyl)propan-2-yl]oxy}carbonyl)amino]-3-phenylpropanoic acid |
| Ddz-L-Phe-OH |
| de(N-methyl)-N-isopropyl-8,9-anhydroerythromycin A 6,9-hemiacetal |