phenyl-(4-phenylselanylphenyl)methanone structure
|
Common Name | phenyl-(4-phenylselanylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 110589-53-2 | Molecular Weight | 337.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14OSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl-(4-phenylselanylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H14OSe |
|---|---|
| Molecular Weight | 337.27400 |
| Exact Mass | 338.02100 |
| PSA | 17.07000 |
| LogP | 2.57260 |
| InChIKey | WETNUBWSJAQPTD-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc([Se]c2ccccc2)cc1 |
|
~88%
phenyl-(4-pheny... CAS#:110589-53-2 |
| Literature: Degrand, Chantal; Prest, Rita; Nour, Mohamed Phosphorus and Sulfur and the Related Elements, 1988 , vol. 38, p. 201 - 210 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methanone,phenyl[4-(phenylseleno)phenyl] |