epi-Sappanol structure
|
Common Name | epi-Sappanol | ||
|---|---|---|---|---|
| CAS Number | 111254-18-3 | Molecular Weight | 304.295 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 583.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.5±30.1 °C | |
Use of epi-SappanolEpisappanol is a natural compound isolated from Caesalpinia sappan heartwood with anti-inflammatory activity. Episappanol significantly inhibits the IL-6 and TNF-α secretion[1]. |
| Name | episappanol |
|---|---|
| Synonym | More Synonyms |
| Description | Episappanol is a natural compound isolated from Caesalpinia sappan heartwood with anti-inflammatory activity. Episappanol significantly inhibits the IL-6 and TNF-α secretion[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 583.1±50.0 °C at 760 mmHg |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.295 |
| Flash Point | 306.5±30.1 °C |
| Exact Mass | 304.094696 |
| PSA | 110.38000 |
| LogP | 0.85 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.740 |
| InChIKey | MPGFEHZDABUJFR-HZPDHXFCSA-N |
| SMILES | Oc1ccc2c(c1)OCC(O)(Cc1ccc(O)c(O)c1)C2O |
| epi-Sappanol |
| (3R,4R)-3-(3,4-Dihydroxybenzyl)-3,4,7-chromanetriol |
| 2H-1-Benzopyran-3,4,7-triol, 3-[(3,4-dihydroxyphenyl)methyl]-3,4-dihydro-, (3R,4R)- |