epi-Nortrachelogenin structure
|
Common Name | epi-Nortrachelogenin | ||
|---|---|---|---|---|
| CAS Number | 125072-69-7 | Molecular Weight | 374.384 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 609.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H22O7 | Melting Point | 170-172℃ | |
| MSDS | N/A | Flash Point | 217.3±23.6 °C | |
Use of epi-NortrachelogeninEpinortrachelogenin ((-)-Epinortrachelogenin) is a natural lignan found in the plateau medicinal plant Daphne acutiloba Rehd[1]. |
| Name | Epinortrachelogenin |
|---|---|
| Synonym | More Synonyms |
| Description | Epinortrachelogenin ((-)-Epinortrachelogenin) is a natural lignan found in the plateau medicinal plant Daphne acutiloba Rehd[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.2±50.0 °C at 760 mmHg |
| Melting Point | 170-172℃ |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.384 |
| Flash Point | 217.3±23.6 °C |
| Exact Mass | 374.136566 |
| PSA | 105.45000 |
| LogP | 0.92 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | ZITBJWXLODLDRH-VBKZILBWSA-N |
| SMILES | COc1cc(CC2COC(=O)C2(O)Cc2ccc(O)c(OC)c2)ccc1O |
| Hazard Codes | Xi |
|---|
| (3R,4S)-3-Hydroxy-3,4-bis(4-hydroxy-3-methoxybenzyl)dihydro-2(3H)-furanone |
| epi-Nortrachelogenin |
| 2(3H)-Furanone, dihydro-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]-, (3R,4S)- |