(4-Phenylthiophenyl)diphenylsulfonium triflate structure
|
Common Name | (4-Phenylthiophenyl)diphenylsulfonium triflate | ||
|---|---|---|---|---|
| CAS Number | 111281-12-0 | Molecular Weight | 520.60700 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H19F3O3S3 | Melting Point | 81-85ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | diphenyl-(4-phenylthiophen-2-yl)sulfanium,trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Melting Point | 81-85ºC(lit.) |
| Molecular Formula | C25H19F3O3S3 |
| Molecular Weight | 520.60700 |
| Exact Mass | 520.04500 |
| PSA | 116.18000 |
| LogP | 8.06540 |
| Index of Refraction | 1.585 |
| InChIKey | WEYUQUMMYNRIPP-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(Sc2ccc([S+](c3ccccc3)c3ccccc3)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,C |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
|
~32%
(4-Phenylthioph... CAS#:111281-12-0 |
| Literature: EP1443042 A1, ; Page 31 ; |
|
~29%
(4-Phenylthioph... CAS#:111281-12-0 |
| Literature: Journal of Organic Chemistry, , vol. 53, # 23 p. 5571 - 5573 |
| MFCD02683569 |
| diphenyl-4-phenylthiophenylsulfonium trifluoromethanesulfonate |
| (4-Phenylthiophenyl)diphenylsulfonium triflate |