N-Glycolylneuraminic acid structure
|
Common Name | N-Glycolylneuraminic acid | ||
|---|---|---|---|---|
| CAS Number | 1113-83-3 | Molecular Weight | 325.269 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 826.1±75.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO10 | Melting Point | 188-190°C | |
| MSDS | Chinese USA | Flash Point | 453.4±37.1 °C | |
Use of N-Glycolylneuraminic acidN-Glycolylneuraminic acid is a nonhuman sialic acid molecule synthesized in pigs but not in humans. N-Glycolylneuraminic acid works as a decoy receptor of N-Glycolylneuraminic acid-binding influenza A viruses (IAVs)[1]. |
| Name | N-glycoloyl-β-neuraminic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Glycolylneuraminic acid is a nonhuman sialic acid molecule synthesized in pigs but not in humans. N-Glycolylneuraminic acid works as a decoy receptor of N-Glycolylneuraminic acid-binding influenza A viruses (IAVs)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 826.1±75.0 °C at 760 mmHg |
| Melting Point | 188-190°C |
| Molecular Formula | C11H19NO10 |
| Molecular Weight | 325.269 |
| Flash Point | 453.4±37.1 °C |
| Exact Mass | 325.100891 |
| PSA | 197.01000 |
| LogP | -2.96 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | FDJKUWYYUZCUJX-AJKRCSPLSA-N |
| SMILES | O=C(CO)NC1C(O)CC(O)(C(=O)O)OC1C(O)C(O)CO |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
The role of sialyl glycan recognition in host tissue tropism of the avian parasite Eimeria tenella.
PLoS Pathog. 7(10) , e1002296, (2011) Eimeria spp. are a highly successful group of intracellular protozoan parasites that develop within intestinal epithelial cells of poultry, causing coccidiosis. As a result of resistance against antic... |
|
|
Determination of sialic acids in milks and milk-based products.
Anal. Biochem. 405(1) , 28-40, (2010) Sialic acids are becoming recognized as important components of milk-based products for infants and young children. As such, many companies now label the sialic acid content of their products. To cont... |
|
|
Production of monoclonal antibodies directed to Hanganutziu-Deicher active gangliosides, N-glycolylneuraminic acid-containing gangliosides.
J. Biochem. 117(5) , 1062-9, (1995) We have established three kinds of monoclonal antibodies against gangliosides containing N-glycolylneuraminic acid (NeuGc) by immunization of BALB/c mice with the purified gangliosides inserted into l... |
| D-glycero-β-D-galacto-2-Nonulopyranosonic acid, 3,5-dideoxy-5-[[(1E)-1,2-dihydroxyethylidene]amino]- |
| Neuraminic acid, N-glycolyl- |
| (6R)-3,5-Dideoxy-5-(glycoloylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]-α-L-threo-hex-2-ulopyranosonic acid |
| NGNA |
| NeuNGl |
| N-Glycolylneuraminate |
| (6R)-3,5-Dideoxy-5-[(E)-(1,2-dihydroxyethylidene)amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]-α-L-threo-hex-2-ulopyranosonic acid |
| 5-Glykoloylamino-D-glycero-D-galacto-3,5-didesoxy-[2]nonulonsaeure |
| N-glycoloyl-β-neuraminic acid |
| N-GLYCOLYNEURAMINIC ACID |
| GcNeu |
| N-Glycolyl Neuraminic Acid |
| MFCD00057551 |
| N-glycoylneuraminic acid |
| N-glycoloyl-neuraminic acid |
| N-Glycolylneuraminic Acid (200 mg) |
| N-glycoloyl-beta-neuraminic acid |
| N-Glykoloyl-neuraminsaeure |
| Glycolylneuraminic Aci |
| N-Glykolyl-neuraminsaeure |
| Neu5Glc NeuNGl |
| Neu5Glc,NeuNGl |
| Neu5Gc |
| Glycolylneuraminic Acid |
| N-GLYCOLYLNEURAMINIC ACID FROM PORCINE*SUBMAXILLARY |
| D-glycero-β-D-galacto-2-Nonulopyranosonic acid, 3,5-dideoxy-5-[(2-hydroxyacetyl)amino]- |
| N-(2-Hydroxyacetyl)-neuraminic Acid |
| 3,5-Dideoxy-5-(glycoloylamino)-D-glycero-β-D-galacto-non-2-ulopyranosonic acid |
| N-(Hydroxyacetyl)neuraminic acid |
| N-Glycolylneuraminic acid |