S-(1,2-Dicarboxyethyl)glutathione structure
|
Common Name | S-(1,2-Dicarboxyethyl)glutathione | ||
|---|---|---|---|---|
| CAS Number | 1115-52-2 | Molecular Weight | 423.39600 | |
| Density | 1.615g/cm3 | Boiling Point | 737.2ºC at 760mmHg | |
| Molecular Formula | C14H21N3O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 399.7ºC | |
Use of S-(1,2-Dicarboxyethyl)glutathioneS-(1,2-Dicarboxyethyl)glutathione is a peptide that inhibits blood coagulation and platelet aggregation[1]. |
| Name | S-(1,2-Dicarboxyethyl)glutathione |
|---|---|
| Synonym | More Synonyms |
| Description | S-(1,2-Dicarboxyethyl)glutathione is a peptide that inhibits blood coagulation and platelet aggregation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.615g/cm3 |
|---|---|
| Boiling Point | 737.2ºC at 760mmHg |
| Molecular Formula | C14H21N3O10S |
| Molecular Weight | 423.39600 |
| Flash Point | 399.7ºC |
| Exact Mass | 423.09500 |
| PSA | 258.72000 |
| Vapour Pressure | 1.54E-34mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | PWCIUOASSAHGHI-WPZUCAASSA-N |
| SMILES | NC(CCC(=O)NC(CSC(CC(=O)O)C(=O)O)C(=O)NCC(=O)O)C(=O)O |
| WGK Germany | 3 |
|---|
|
~%
S-(1,2-Dicarbox... CAS#:1115-52-2 |
| Literature: Morgan; Friedmann Biochemical Journal, 1938 , vol. 32, p. 736 |
|
~%
S-(1,2-Dicarbox... CAS#:1115-52-2
Detail
Learn More
|
| Literature: Morgan; Friedmann Biochemical Journal, 1938 , vol. 32, p. 737,862 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
|
Name: ERK5 transcriptional activity HTS
Source: 24565
Target: N/A
External Id: ERK5 transcriptional activity-HTS
|
|
Name: Human Phosphogluconate dehydrogenase (6PGD) Inhibitor Screening
Source: 11827
Target: Phosphogluconate dehydrogenase
External Id: 6PGD_Inhibitor_Screening_2015_09
|
| S-(1.2-Dicarboxy-aethyl)-glutathion |
| 2-[(2R)-2-amino-3-[[(4S)-4-amino-5-hydroxy-5-oxopentanoyl]-(carboxymethyl)amino]-3-oxopropyl]sulfanylbutanedioic acid |
| [2-(4-Amino-4-carboxybutyrylamino)-3-[(1,2-dicarboxyethyl)thio]propanoylamino]acetic acid |
| 2-[[(2R)-2-amino-3-[[(4S)-4-amino-5-hydroxy-5-keto-pentanoyl]-(carboxymethyl)amino]-3-keto-propyl]thio]succinic acid |
| GLU[CYS(1,2-DICARBOXYETHYL)-GLY] |
| 2-[2-(4-Amino-4-carboxybutyrylamino)-3-oxo-3-(carboxymethylamino)propylthio]succinic acid |
| H-GLU(CYS(1,2-DICARBOXYETHYL)-GLY-OH)-OH |
| 2-[[2-[(4-Amino-4-carboxy-1-oxobutyl)amino]-3-[(carboxymethyl)amino]-3-oxopropyl]thio]butanedioic acid |