Fmoc-Phe-Lys(Trt)-PAB-PNP
Modify Date: 2025-08-25 10:16:32
Fmoc-Phe-Lys(Trt)-PAB-PNP structure
|
Common Name | Fmoc-Phe-Lys(Trt)-PAB-PNP | ||
|---|---|---|---|---|
| CAS Number | 1116086-09-9 | Molecular Weight | 1028.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C63H57N5O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Phe-Lys(Trt)-PAB-PNPFmoc-Phe-Lys(Trt)-PAB-PNP is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Fmoc-Phe-Lys(Trt)-PAB-PNP |
|---|
| Description | Fmoc-Phe-Lys(Trt)-PAB-PNP is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| Molecular Formula | C63H57N5O9 |
|---|---|
| Molecular Weight | 1028.15 |
| InChIKey | LOGURWMJSNXIEZ-YQOHNZFASA-N |
| SMILES | NC(=O)C(CCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)N(C(=O)C(Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| Storage condition | -20°C |