N-(tert-Butoxycarbonyl)glycine tert-Butyl Ester structure
|
Common Name | N-(tert-Butoxycarbonyl)glycine tert-Butyl Ester | ||
|---|---|---|---|---|
| CAS Number | 111652-20-1 | Molecular Weight | 231.289 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 306.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | 66-68ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 138.9±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-(tert-Butoxycarbonyl)glycine tert-Butyl Estertert-Butyl 2-((tert-butoxycarbonyl)amino)acetate is a Glycine (HY-Y0966) derivative[1]. |
| Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| Synonym | More Synonyms |
| Description | tert-Butyl 2-((tert-butoxycarbonyl)amino)acetate is a Glycine (HY-Y0966) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 306.0±25.0 °C at 760 mmHg |
| Melting Point | 66-68ºC(lit.) |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.289 |
| Flash Point | 138.9±23.2 °C |
| Exact Mass | 231.147064 |
| PSA | 64.63000 |
| LogP | 2.44 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.444 |
| InChIKey | ZDKFMHKWZATBMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CNC(=O)OC(C)(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xn |
| Risk Phrases | 22-51 |
| Safety Phrases | 20/21-29/56 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924199090 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| t-BuO2CCH2NHBoc |
| Boc-glycine tert-butyl ester |
| tert-butyl N-Boc-glycinate |
| Glycine, N-[(1,1-dimethylethoxy)carbonyl]-, 1,1-dimethylethyl ester |
| Boc-Glycine |
| N-(tert-Butoxycarbonyl)-3-methyl-L-valine |
| N-Boc-glycine t-butyl ester |
| MFCD00191866 |
| L-Valine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl- |
| N-(tert-Butoxycarbonyl)glycine tert-Butyl Ester |
| N-Boc-glycine tert-Butyl Ester |
| BOC-GLYCINETERT-BUTYLESTER |
| 2-Methyl-2-propanyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate |
| 3-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-valine |
| Boc-Gly-OtBu |
| tert-Butyl 2-((tert-butoxycarbonyl)amino)acetate |