LIMK-IN-14 structure
|
Common Name | LIMK-IN-14 | ||
|---|---|---|---|---|
| CAS Number | 1116570-97-8 | Molecular Weight | 437.49500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H27N7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LIMK-IN-14A potent, selective LIMK inhibitor with IC50 of 0.9 nM and 0.5 nM and 1.2 nM for LIMK1 and LIMK2, respectively. |
| Name | 3-({[(2S)-2-Methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1 -piperazinyl]carbonyl}amino)phenyl dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H27N7O3 |
|---|---|
| Molecular Weight | 437.49500 |
| Exact Mass | 437.21800 |
| PSA | 110.18000 |
| LogP | 3.08580 |
| InChIKey | MVPARBNSRQJBEM-HNNXBMFYSA-N |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(C(=O)Nc4cccc(OC(=O)N(C)C)c4)C(C)C3)c12 |
|
~84%
LIMK-IN-14 CAS#:1116570-97-8 |
| Literature: US2009/42893 A1, ; Page/Page column 8 ; US 20090042893 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| LIMK-IN-14 |