2-cyanomethyl-3-nitro-6-methoxy pyridine structure
|
Common Name | 2-cyanomethyl-3-nitro-6-methoxy pyridine | ||
|---|---|---|---|---|
| CAS Number | 111795-99-4 | Molecular Weight | 193.15900 | |
| Density | 1.334g/cm3 | Boiling Point | 345.6ºC at 760 mmHg | |
| Molecular Formula | C8H7N3O3 | Melting Point | 116-117℃ (ethanol ) | |
| MSDS | Chinese USA | Flash Point | 162.8ºC | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 2-(6-methoxy-3-nitropyridin-2-yl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 345.6ºC at 760 mmHg |
| Melting Point | 116-117℃ (ethanol ) |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.15900 |
| Flash Point | 162.8ºC |
| Exact Mass | 193.04900 |
| PSA | 91.73000 |
| LogP | 1.58768 |
| Vapour Pressure | 6.09E-05mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | KOOPAOCWSWOMQI-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(CC#N)n1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 25-41 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
|
~96%
2-cyanomethyl-3... CAS#:111795-99-4 |
| Literature: Jeanty, Matthieu; Suzenet, Franck; Guillaumet, Gerald Journal of Organic Chemistry, 2008 , vol. 73, # 18 p. 7390 - 7393 |
|
~80%
2-cyanomethyl-3... CAS#:111795-99-4 |
| Literature: Jonczyk, Andrzej; Kowalkowska, Anna Synthesis, 2002 , # 5 p. 674 - 680 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| (6-methoxy-3-nitropyridin-2-yl)acetonitrile |
| 2-pyridineacetonitrile,6-methoxy-3-nitro |
| 2-(3-nitro-6-methoxypyrid-2-yl)acetonitrile |
| 2-(6-Methoxy-3-nitropyrid-2-yl)acetonitrile |
| 6-Methoxy-3-nitropyridine-2-acetonitrile |
| (6-methoxy-3-nitro-2-pyridyl)acetonitrile |
| 2-cyanomethyl-6-methoxy-3-nitropyridine |