Bexagliflozin structure
|
Common Name | Bexagliflozin | ||
|---|---|---|---|---|
| CAS Number | 1118567-05-7 | Molecular Weight | 464.936 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 671.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H29ClO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 359.6±31.5 °C | |
Use of BexagliflozinBexagliflozin is a potent and selective SGLT2 inhibitor with IC50 value of 5.6 μM /2 nM in SGLT1 /SGLT2 respectively.target: SGLT2IC50: 5.6 μM (SGLT1)/ 2 nM (SGLT2)1) In normal rats and dogs a saturable urinary glucose excretion was produced with an ED50 of 0.38 and 0.09 mg/kg, respectively.2) EGT1442 significantly prolonged the median survival of SHRSP rats.3) EGT1442 dose-dependently reduced HbA1c and blood glucose concentration without affecting body mass or insulin level. |
| Name | (2S,3R,4R,5S,6R)-2-(4-chloro-3-(4-(2-cyclopropoxyethoxy)benzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Description | Bexagliflozin is a potent and selective SGLT2 inhibitor with IC50 value of 5.6 μM /2 nM in SGLT1 /SGLT2 respectively.target: SGLT2IC50: 5.6 μM (SGLT1)/ 2 nM (SGLT2)1) In normal rats and dogs a saturable urinary glucose excretion was produced with an ED50 of 0.38 and 0.09 mg/kg, respectively.2) EGT1442 significantly prolonged the median survival of SHRSP rats.3) EGT1442 dose-dependently reduced HbA1c and blood glucose concentration without affecting body mass or insulin level. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 671.0±55.0 °C at 760 mmHg |
| Molecular Formula | C24H29ClO7 |
| Molecular Weight | 464.936 |
| Flash Point | 359.6±31.5 °C |
| Exact Mass | 464.160187 |
| PSA | 108.61000 |
| LogP | 3.92 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | BTCRKOKVYTVOLU-SJSRKZJXSA-N |
| SMILES | OCC1OC(c2ccc(Cl)c(Cc3ccc(OCCOC4CC4)cc3)c2)C(O)C(O)C1O |
| Storage condition | 2-8℃ |
| THR-1442 |
| (1S)-1,5-Anhydro-1-(4-chloro-3-{4-[2-(cyclopropyloxy)ethoxy]benzyl}phenyl)-D-glucitol |
| EGT0001442 |
| UNII:EY00JF42FV |
| THR1442 |
| bexagliflozin |
| D-Glucitol, 1,5-anhydro-1-C-[4-chloro-3-[[4-[2-(cyclopropyloxy)ethoxy]phenyl]methyl]phenyl]-, (1S)- |
| EGT1442 |