Adenanthin structure
|
Common Name | Adenanthin | ||
|---|---|---|---|---|
| CAS Number | 111917-59-0 | Molecular Weight | 490.543 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 593.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C26H34O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.6±23.6 °C | |
Use of AdenanthinAdenanthin is an inhibitor of thiol-dependent antioxidant enzymes, targeting to Prx 1 and Prx 2. Adenanthin impairs human natural killer (NK) cells effector functions, and killing hepatocellular carcinoma cells. Adenanthin inhibits NF-κB signaling and lipogenesis and the development of obesity by regulating ROS[1]. |
| Name | (1α,3β,5β,7β,8α,9β,10α,11β)-3-Hydroxy-6,15-dioxokaur-16-ene-1,7,1 1-triyl triacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Adenanthin is an inhibitor of thiol-dependent antioxidant enzymes, targeting to Prx 1 and Prx 2. Adenanthin impairs human natural killer (NK) cells effector functions, and killing hepatocellular carcinoma cells. Adenanthin inhibits NF-κB signaling and lipogenesis and the development of obesity by regulating ROS[1]. |
|---|---|
| Related Catalog | |
| Target |
Prx 1, Prx 2, NF-κB[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 593.4±50.0 °C at 760 mmHg |
| Molecular Formula | C26H34O9 |
| Molecular Weight | 490.543 |
| Flash Point | 192.6±23.6 °C |
| Exact Mass | 490.220276 |
| PSA | 133.27000 |
| LogP | 1.36 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | WQVYSFSBBFDGRG-FYHXSELJSA-N |
| SMILES | C=C1C(=O)C23CC1CC(OC(C)=O)C2C1(C)C(OC(C)=O)CC(O)C(C)(C)C1C(=O)C3OC(C)=O |
| Hazard Codes | Xi |
|---|
| (1α,3β,5β,7β,8α,9β,10α,11β)-3-Hydroxy-6,15-dioxokaur-16-ene-1,7,11-triyl triacetate |