Deoxycholic acid-d4 structure
|
Common Name | Deoxycholic acid-d4 | ||
|---|---|---|---|---|
| CAS Number | 112076-61-6 | Molecular Weight | 396.60 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 547.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C24H36D4O4 | Melting Point | 171-174ºC | |
| MSDS | Chinese USA | Flash Point | 298.8±22.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-2,2,4,4-tetradeuterio-3,12-dihydroxy-10,13-dimethyl-3,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description |
|---|
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 547.1±35.0 °C at 760 mmHg |
| Melting Point | 171-174ºC |
| Molecular Formula | C24H36D4O4 |
| Molecular Weight | 396.60 |
| Flash Point | 298.8±22.4 °C |
| Exact Mass | 396.317780 |
| PSA | 77.76000 |
| LogP | 4.66 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | KXGVEGMKQFWNSR-FCSCGBJGSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
Persistent Organic Pollutants Modify Gut Microbiota-Host Metabolic Homeostasis in Mice Through Aryl Hydrocarbon Receptor Activation.
Environ. Health Perspect. 123 , 679-88, (2015) Alteration of the gut microbiota through diet and environmental contaminants may disturb physiological homeostasis, leading to various diseases including obesity and type 2 diabetes. Because most expo... |
| 7-Deoxycholic acid,-2,2,4,4-d4 |
| (3α,5β,12α)-3,12-Dihydroxy(2,2,4,4-H)cholan-24-oic acid |
| Cholan-24-oic-2,2,4,4-d acid, 3,12-dihydroxy-, (3α,5β,12α)- |
| Deoxycholic acid-2,2,4,4-d4 |
| 3a,12a-Dihydroxy-5|A-cholanic acid-2,2,4,4-d4 |
| Desoxycholic acid-2,2,4,4-d4 |