N-(6-oxo-3-phenyl-1H-1,2,4-triazin-5-yl)benzamide structure
|
Common Name | N-(6-oxo-3-phenyl-1H-1,2,4-triazin-5-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 112371-92-3 | Molecular Weight | 292.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(6-oxo-3-phenyl-1H-1,2,4-triazin-5-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N4O2 |
|---|---|
| Molecular Weight | 292.29200 |
| Exact Mass | 292.09600 |
| PSA | 91.49000 |
| LogP | 2.88050 |
| InChIKey | IVKSLVVFQNEWMY-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nc(-c2ccccc2)n[nH]c1=O)c1ccccc1 |
|
~76%
N-(6-oxo-3-phen... CAS#:112371-92-3 |
| Literature: Jacobsen, Noel W.; Philippides, Athena E. Australian Journal of Chemistry, 1987 , vol. 40, # 4 p. 693 - 699 |
|
~%
N-(6-oxo-3-phen... CAS#:112371-92-3 |
| Literature: Jacobsen, Noel W.; Philippides, Athena E. Australian Journal of Chemistry, 1987 , vol. 40, # 4 p. 693 - 699 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-benzoylamino-3-phenyl-1,2,4-triazin-6(1H)-one |
| Benzamide,N-(1,6-dihydro-6-oxo-3-phenyl-1,2,4-triazin-5-yl) |