Fmoc-His(Tos)-OH structure
|
Common Name | Fmoc-His(Tos)-OH | ||
|---|---|---|---|---|
| CAS Number | 112380-10-6 | Molecular Weight | 531.580 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C28H25N3O6S | Melting Point | 170-174ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Melting Point | 170-174ºC (dec.) |
| Molecular Formula | C28H25N3O6S |
| Molecular Weight | 531.580 |
| Exact Mass | 531.146423 |
| PSA | 135.97000 |
| LogP | 4.58 |
| Index of Refraction | 1.677 |
| InChIKey | PHAKSHNECOECCD-SANMLTNESA-N |
| SMILES | Cc1ccc(S(=O)(=O)n2cnc(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)c2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-{1-[(4-methylphenyl)sulfonyl]-1H-imidazol-4-yl}propanoic acid |
| Fmoc-L-His(Ts)-OH |
| Fmoc-His(Tos) |
| Fmoc-His(Tos)-OH |
| L-Histidine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-1-[(4-methylphenyl)sulfonyl]- |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-[(4-methylphenyl)sulfonyl]-L-histidine |