3'-Demethylnobiletin structure
|
Common Name | 3'-Demethylnobiletin | ||
|---|---|---|---|---|
| CAS Number | 112448-39-2 | Molecular Weight | 388.36800 | |
| Density | 1.304g/cm3 | Boiling Point | 613.8ºC at 760 mmHg | |
| Molecular Formula | C20H20O8 | Melting Point | 170-171 ºC | |
| MSDS | N/A | Flash Point | 218.8ºC | |
Use of 3'-Demethylnobiletin3'-Demethylnobiletin, a derivative of Nobiletin, is a polymethoxyflavonoid in citrus fruits[1]. Nobiletin exhibits anticancer activity and inhibits tumor angiogenesis by regulating Src, FAK, and STAT3 signaling[2]. |
| Name | 2-(3-hydroxy-4-methoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-Demethylnobiletin, a derivative of Nobiletin, is a polymethoxyflavonoid in citrus fruits[1]. Nobiletin exhibits anticancer activity and inhibits tumor angiogenesis by regulating Src, FAK, and STAT3 signaling[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 613.8ºC at 760 mmHg |
| Melting Point | 170-171 ºC |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.36800 |
| Flash Point | 218.8ºC |
| Exact Mass | 388.11600 |
| PSA | 96.59000 |
| LogP | 3.20860 |
| Vapour Pressure | 1.17E-15mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | XFYYZBJXMSDKCV-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1O |
| Water Solubility | Practically insoluble (0.039 g/L) (25 ºC) |
| 4H-1-Benzopyran-4-one,2-(3-hydroxy-4-methoxyphenyl)-5,6,7,8-tetramethoxy |
| 3'-hydroxy-5,6,7,8,4'-pentamethoxyflavone |
| 7-Hydroxy-3',4',5,6-tetramethoxyflavone |
| 3'-Demethylnobiletin |