4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol structure
|
Common Name | 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 112559-81-6 | Molecular Weight | 299.324 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 540.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.9±30.1 °C | |
| Name | 4-[4-(4-nitrophenyl)piperazin-1-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 540.8±50.0 °C at 760 mmHg |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.324 |
| Flash Point | 280.9±30.1 °C |
| Exact Mass | 299.126984 |
| PSA | 72.53000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | BNHYDULILNJFFY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(c3ccc(O)cc3)CC2)cc1 |
| HS Code | 2933599090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol |
| Phenol,4-[4-(4-nitrophenyl)-1-piperazinyl] |
| N-(4-hydroxyphenyl)-N'-(4'-nitrophenyl)-piperazine |
| 4-[4-(4-Nitrophenyl)-1-piperazinyl]phenol |
| MFCD08460988 |
| 4-(4-[4-nitrophenyl]piperazin-1-yl)phenol |
| 4-[4-(4-Nitrophenyl)piperazin-1-yl]phenol |
| Phenol, 4-[4-(4-nitrophenyl)-1-piperazinyl]- |
| Posaconazole Impurity 56 |