1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine structure
|
Common Name | 1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 74852-61-2 | Molecular Weight | 313.35100 | |
| Density | 1.239 g/cm3 | Boiling Point | 515.7ºC at 760 mmHg | |
| Molecular Formula | C17H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.7ºC | |
| Name | 1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239 g/cm3 |
|---|---|
| Boiling Point | 515.7ºC at 760 mmHg |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.35100 |
| Flash Point | 265.7ºC |
| Exact Mass | 313.14300 |
| PSA | 61.53000 |
| LogP | 3.58320 |
| Index of Refraction | 1.61 |
| InChIKey | AVCKOFMRPAJEPN-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| HS Code | 2933599090 |
|---|
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 1-(4-methoxyphonyl)-4-(4-nitrophenyl)piperazine |
| 1-(4-methoxyphenyl)-4-(4-nitrophenyl)-piperazine |
| PIP024 |
| N-(4-methoxyphenyl)-N'-(4-nitrophenyl)-piperazine |
| MFCD01604435 |
| Posaconazole Impurity 55 |