BR-Xanthone A structure
|
Common Name | BR-Xanthone A | ||
|---|---|---|---|---|
| CAS Number | 112649-48-6 | Molecular Weight | 396.433 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 609.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.3±25.0 °C | |
| Name | 5,13-Dihydroxy-3,3,10,10-tetramethyl-2,3,11,12-tetrahydro-10H-dip yrano[3,2-a:2',3'-i]xanthen-14(1H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.7±55.0 °C at 760 mmHg |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.433 |
| Flash Point | 214.3±25.0 °C |
| Exact Mass | 396.157288 |
| PSA | 89.13000 |
| LogP | 5.42 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | QFURCBFEIGTKCW-UHFFFAOYSA-N |
| SMILES | CC1(C)CCc2c(cc3oc4cc(O)c5c(c4c(=O)c3c2O)CCC(C)(C)O5)O1 |
| Hazard Codes | Xi |
|---|
|
~%
BR-Xanthone A CAS#:112649-48-6 |
| Literature: Dutta, P. K.; Sen, A. K.; Sarkar, K. K.; Banerji, N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, # 1-12 p. 281 - 282 |
|
~%
BR-Xanthone A CAS#:112649-48-6 |
| Literature: Dutta, P. K.; Sen, A. K.; Sarkar, K. K.; Banerji, N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, # 1-12 p. 281 - 282 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Gridball |
| BR-xanthone A |
| Velpar |
| 10H-Dipyrano[3,2-a:2',3'-i]xanthen-14(1H)-one, 2,3,11,12-tetrahydro-5,13-dihydroxy-3,3,10,10-tetramethyl- |
| 5,13-Dihydroxy-3,3,10,10-tetramethyl-2,3,11,12-tetrahydro-10H-dipyrano[3,2-a:2',3'-i]xanthen-14(1H)-one |
| Velpar weed killer |
| 1-methyl-3-cyclohexyl-6-dimethylamino-1,3,5-triazin-2,4-dione |
| BR-xanthone H |
| Brush Killer |
| Caswell No. 271AA |
| Velpar L |
| HEXAZINONE |