2,4,5-Trifluoro-3-methoxybenzoyl chloride structure
|
Common Name | 2,4,5-Trifluoro-3-methoxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 112811-66-2 | Molecular Weight | 224.564 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 229.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClF3O2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 94.6±15.1 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2,4,5-Trifluoro-3-methoxybenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 229.2±35.0 °C at 760 mmHg |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.564 |
| Flash Point | 94.6±15.1 °C |
| Exact Mass | 223.985199 |
| PSA | 26.30000 |
| LogP | 2.44 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | JVQSZTJTWSUJCR-UHFFFAOYSA-N |
| SMILES | COc1c(F)c(F)cc(C(=O)Cl)c1F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R14;R20/21/22;R34;R36/37/38 |
| Safety Phrases | S26-S36/37/39-S45-S24/25-S23-S8-S30 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2918990090 |
|
~98%
2,4,5-Trifluoro... CAS#:112811-66-2 |
| Literature: Chen, Yin-Bo; Li, Ji-Ling; Shao, Xu-Sheng; Xu, Xiao-Yong; Li, Zhong Chinese Chemical Letters, 2013 , vol. 24, # 8 p. 673 - 676 |
|
~%
2,4,5-Trifluoro... CAS#:112811-66-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 47, # 19 p. 4693 - 4709 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,3,5-trifluoro-4-methoxybenzoyl chloride |
| MFCD02682012 |
| 2,4,5-tifluoro-3-Methoxybenzoylchloride |
| Benzoyl chloride, 2,4,5-trifluoro-3-methoxy- |
| 2,4,5-Trifluoro-3-methoxybenzoyl chloride |
| GVR BF DF EF CO1 |
| 3-METHOXY-2,4,5-TRIFLUOROBENZOYL CHLORIDE |
| 2,4,5-Trifluoro-3-me |
| 2,4,5-trifluoro-3-methoxybenzoic acid chloride |
| 2,4,5-Trifluoro-m-anisoyl chloride |
| 2,3-DIHYDRO-1H-INDOLE-6-CARBOXYLIC ACID |