HYDROQUINIDINE 4-CHLOROBENZOATE structure
|
Common Name | HYDROQUINIDINE 4-CHLOROBENZOATE | ||
|---|---|---|---|---|
| CAS Number | 113162-02-0 | Molecular Weight | 464.98400 | |
| Density | 1.28g/cm3 | Boiling Point | 598ºC at 760mmHg | |
| Molecular Formula | C27H29ClN2O3 | Melting Point | 102-105ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 315.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [(S)-[(2R,4S,5S)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 598ºC at 760mmHg |
| Melting Point | 102-105ºC(lit.) |
| Molecular Formula | C27H29ClN2O3 |
| Molecular Weight | 464.98400 |
| Flash Point | 315.5ºC |
| Exact Mass | 464.18700 |
| PSA | 51.66000 |
| LogP | 5.85320 |
| Vapour Pressure | 2.91E-14mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | TXVNNFDXQZFMBQ-PRUVNFMMSA-N |
| SMILES | CCC1CN2CCC1CC2C(OC(=O)c1ccc(Cl)cc1)c1ccnc2ccc(OC)cc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36-24/25-22 |
| RIDADR | UN 1544 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
~77%
HYDROQUINIDINE ... CAS#:113162-02-0 |
| Literature: Mohar, Barbara; Baudoux, Jerome; Plaquevent, Jean-Christophe; Cahard, Dominique Angewandte Chemie - International Edition, 2001 , vol. 40, # 22 p. 4214 - 4216 |
|
~%
HYDROQUINIDINE ... CAS#:113162-02-0 |
| Literature: Russian Journal of Organic Chemistry, , vol. 30, # 11.1 p. 1735 - 1740 Zhurnal Organicheskoi Khimii, , vol. 30, # 11 p. 1650 - 1655 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| dihydrochinidinyl p-chlorobenzoate |
| MFCD00151148 |
| Dihydroquinidine 4-chlorobenzoate |
| p-Chlorobenzoyldihydroquinidine |
| 10,11-dihydroquinidine p-chlorobenzoate |
| O-(4-Chlorobenzoyl)hydroquinidine |
| Hydroquinidine 4-chlorobenzoate |