Epimagnolin B structure
|
Common Name | Epimagnolin B | ||
|---|---|---|---|---|
| CAS Number | 1134188-26-3 | Molecular Weight | 416.464 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 548.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H28O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9±30.0 °C | |
Use of Epimagnolin BEpimagnolin B is a bisepoxylignan isolated from Magnolia fargesii, with anti-inflammatory activity and antiallergic effects. Epimagnolin B inhibits NO production in LPS-activated microglia. Epimagnolin B exhibited antiallergic effects[1][2]. |
| Name | (1R,3aR,4S,6aR)-1-(3,5-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan |
|---|---|
| Synonym | More Synonyms |
| Description | Epimagnolin B is a bisepoxylignan isolated from Magnolia fargesii, with anti-inflammatory activity and antiallergic effects. Epimagnolin B inhibits NO production in LPS-activated microglia. Epimagnolin B exhibited antiallergic effects[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Epimagnolin B exhibits antiallergic effects without affecting the viability of BMMCs[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 548.2±50.0 °C at 760 mmHg |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.464 |
| Flash Point | 220.9±30.0 °C |
| Exact Mass | 416.183502 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | DTZKTJXOROSTPI-YHDSQAASSA-N |
| SMILES | COc1cc(OC)cc(C2OCC3C(c4cc(OC)c(OC)c(OC)c4)OCC23)c1 |
| Storage condition | 2-8℃ |
| (1R,3aR,4S,6aR)-1-(3,5-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan |
| 1H,3H-Furo[3,4-c]furan, 1-(3,5-dimethoxyphenyl)tetrahydro-4-(3,4,5-trimethoxyphenyl)-, (1R,3aR,4S,6aR)- |